Chemical synthesis of dimer ribonucleotides containing internucleotidic phosphorodithioate linkages
Publikation: Bidrag til tidsskrift › Tidsskriftartikel › Forskning › fagfællebedømt
Ribonucleosides, chlorobis(amino)phosphines and thiols react via phosphorothioamidites to form phosphorothioites. Oxidation with sulphur gives ribonucleoside phosphorodithioate triesters which after deprotection yields the phosphorodithioate ribonucleoside analogues.
| Originalsprog | Engelsk |
|---|---|
| Tidsskrift | Tetrahedron Letters |
| Vol/bind | 31 |
| Udgave nummer | 6 |
| Sider (fra-til) | 911-914 |
| Antal sider | 4 |
| ISSN | 0040-4039 |
| DOI | |
| Status | Udgivet - 1 jan. 1990 |
ID: 131117535